ChemNet > CAS > 69604-00-8 Ethyl 5-nitrobenzofuran-2-carboxylate
69604-00-8 Ethyl 5-nitrobenzofuran-2-carboxylate
| product Name |
Ethyl 5-nitrobenzofuran-2-carboxylate |
| Synonyms |
5-Nitrobenzo[b]furan-2-carboxylic acid ethyl ester; 5-nitro-benzofuran-2-carboxylic acid ethyl ester; Vilazodone Intermediate 7; Ethyl 5-nitrobenzo[b]furan-2-carboxylate |
| Molecular Formula |
C11H9NO5 |
| Molecular Weight |
235.1929 |
| InChI |
InChI=1/C11H9NO5/c1-2-16-11(13)10-6-7-5-8(12(14)15)3-4-9(7)17-10/h3-6H,2H2,1H3 |
| CAS Registry Number |
69604-00-8 |
| Molecular Structure |
|
| Density |
1.362g/cm3 |
| Melting point |
150℃ |
| Boiling point |
359.7°C at 760 mmHg |
| Refractive index |
1.603 |
| Flash point |
171.3°C |
| Vapour Pressur |
2.34E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
